pinappleloverr123 pinappleloverr123

20-02-2020
Mathematics

contestada

Multiply the polynomials

Multiply the polynomials class=

Respuesta :

krupashah2005 krupashah2005

24-02-2020

Answer:

the fourth one is the answer

15x^5 + 12x^4

you multiply the coefficients and add the exponents

Answer Link

Otras preguntas

please helpppp me i can not figure this out it is an attachment

The fuel efficiency of a car decreases as tire pressure decreases. What's the independent variable in the situation? Question 1 options: A) Fuel efficiency B) T

The object of a preposition can function as a(n) ______ clause

What is the purpose of the establishment clause? Oto give citizens the right to form religious groups to stop government from supporting one religion O to give

explain why the rate of the forward reaction decrease with time

A segment that connects two points on a circle is called a A. circumference B. chord C. radius D. diameter

Let sin A = 1/3 where A terminates in Quadrant 1, and let cos B = 2/3, where B terminates in Quadrant 4. Using the identity: cos(A-B)=cosACosB+sinAsinB find co

T/F : the mental disorder most closely associated with violent and serious offenses is schizophrenia.

The performance measure which answers the question "Are we maintaining our ability to change and improve?" is: a. internal business processes. b. customer. c. f

Hansel asked 40 members of the school orchestra how many minutes they spent practicing the previous weekend. He collected this data. 87, 105, 121, 86, 85, 112,