ashley8890 ashley8890

16-12-2019
Mathematics

contestada

What is the solution of the system?
y= -2x+18
y+(3/4)=(1/2)x

Respuesta :

BrainyAlice28 BrainyAlice28

16-12-2019

y= -2x + 18

y= 0.5x + 0.75

-2x+18 = 0.5x + 0.75

-2.5x = -17.25

x= 6.9

Answer Link

Otras preguntas

1 to the power of 2 + 2 to the power of 3 + 3 to the power of 4

In what specific ways did hip-hop help Walker and her friends overcome their differences?

removedfc0a19b54de122cb9ed527a15aa84316a25144f7092fcb504631074299d34339removed 2m68-57-20-4f-a59d-29884 33% part (a) what is the resistance, in kilohms, of the

Perform the following mathematical operation and report the answer to the appropriate number of significant figures. 7.273 - 12.37 = [?]

Why your chosen culture is in danger of being forgotten or ruined and suggest possible solution? (own opinion please)

find the value of cot R

(x,y)=y is brother of x is a function

nswer Draw and name the following compound CH3CHCHCH(CH3)CH(CH3)CH2CH2CH3 CECEC-

PLEASE HELP QUICK!!!!!!! What is the simplified expression for 2 power 2 multiplied by 2 power 3 over 2 power 4? A) 2 power 0 B) 2 power 1 C) 2 power 2 D) 2 pow

a line is drawn perpendicular to y=(1/2)x+6 and passes through the points (b,1) and (-3,2). what is the value of b