dfkjkdife dfkjkdife

18-12-2020
Mathematics

contestada

what does 3(1+x)-5=3x-2 equal ?

Respuesta :

maliasmith2468 maliasmith2468

18-12-2020

Answer:

0

Step-by-step explanation:

Theres different ways you can solve this but the way I did it both sides were equal to eachother.

Answer Link

Otras preguntas

Describe the end behavior of the graph of the function f(x)=−5(4)^x−2 As x→−∞, f(x)→ As x→∞ , f(x)→

write the letter identifying each reaction : Synthesis H2CO3 CO2 + H2O

Relire les chapitres 3 à 9 inclus puis noter les idées (au moins 5) qui correspondent aux thèmes suivants : 1. Une nature sauvage - 2. Construire et civiliser.

Write an equation for the function graphed above. y =

pls answer fast 17 points

. A loan of K50,000 is to be paid in full at the end of 10 years at 12.5% p.a for the duration of the loan. What lump sump will be required to terminate this lo

average rate of change for r=6sin2θ

Is CH3CH2CH(CH3CH2)CH(CH3)CH2(CH3) 3-ethyl-4,5-dimethylpentane ?

Find the number of terms in this polynomial. –3t2

Which statement best describes what makes the united states a global vanguard of freedom, democracy, and opportunity?A. It was focused on making every country i